Natural Compounds

ST090359


Formula: C10H12N4O5

MW: 268.23

Atorel; beta-D-Ribofuranoside, hypoxanthine-9; beta-Inosine; HXR; Hypoxanthine D-riboside; Hypoxanthine, 9-beta-D-ribofuranosyl-; hypoxanthined-riboside; hypoxanthinenucleoside

LogP: 3.01

LogS: -3.69

Acceptors: 5

Donors: 4

Rotation Bonds: 6

Chiral Centers: 4

N+O: 9

LIPINSKY: 4

IUPAC: 2-(hydroxymethyl)-5-(6-hydroxypurin-9-yl)oxolane-3,4-diol

Smiles: n1(C2C(C(O)C(O2)CO)O)c2c(c(O)ncn2)nc1