Natural Compounds

ST090381


Formula: C14H19N5O5

MW: 337.34

LogP: 0.71

LogS: -3.66

Acceptors: 5

Donors: 4

Rotation Bonds: 6

Chiral Centers: 3

N+O: 10

LIPINSKY: 4

IUPAC: N-{6-hydroxy-9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl}-2-methylpro panamide

Smiles: n1(c2c(c(O)nc(n2)NC(=O)C(C)C)nc1)C1OC(CO)C(C1)O