Natural Compounds

ST092583


Formula: C46H48N2O6S2

MW: 789.03

LogP: 5.07

LogS: -5.18

Acceptors: 6

Donors: 6

Rotation Bonds: 17

Chiral Centers: 0

N+O: 8

LIPINSKY: 2

IUPAC: 8-((1E)-4-phenylthio-2-azabut-1-enyl)-2-[8-((1E)-4-phenylthio-2-azabut-1-enyl) -1,6,7-trihydroxy-3-methyl-5-(methylethyl)(2-naphthyl)]-3-methyl-5-(methylethy l)naphthalene-1,6,7-triol

Smiles: c1(c2c(c3c(c(O)c(c(c3cc2C)C(C)C)O)/C=NCCSc2ccccc2)O)c(c2c(c(O)c(c(c2cc1C)C(C)C)O)/C=NCCSc1ccccc1)O