Natural Compounds

ST092584


Formula: C52H56N2O8

MW: 837.03

LogP: 2.25

LogS: -3.46

Acceptors: 8

Donors: 6

Rotation Bonds: 19

Chiral Centers: 0

N+O: 10

LIPINSKY: 2

IUPAC: 8-((1E)-4-indan-5-yloxy-2-azabut-1-enyl)-2-[8-((1E)-4-indan-5-yloxy-2-azabut-1 -enyl)-1,6,7-trihydroxy-3-methyl-5-(methylethyl)(2-naphthyl)]-3-methyl-5-(meth ylethyl)naphthalene-1,6,7-triol

Smiles: c1(c2c(c3c(c(O)c(c(c3cc2C)C(C)C)O)/C=NCCOc2cc3CCCc3cc2)O)c(c2c(c(O)c(c(c2cc1C)C(C)C)O)/C=NCCOc1cc2CCCc2cc1)O