Natural Compounds

ST092585


Formula: C38H48N2O6S2

MW: 692.94

LogP: 0.21

LogS: -2.86

Acceptors: 6

Donors: 6

Rotation Bonds: 19

Chiral Centers: 0

N+O: 8

LIPINSKY: 2

IUPAC: 8-((1E)-4-ethylthio-2-azabut-1-enyl)-2-[8-((1E)-4-ethylthio-2-azabut-1-enyl)-1 ,6,7-trihydroxy-3-methyl-5-(methylethyl)(2-naphthyl)]-3-methyl-5-(methylethyl) naphthalene-1,6,7-triol

Smiles: c1(c2c(c3c(c(O)c(c(c3cc2C)C(C)C)O)/C=NCCSCC)O)c(c2c(c(O)c(c(c2cc1C)C(C)C)O)/C=NCCSCC)O