Natural Compounds

ST092586


Formula: C58H52N2O10

MW: 937.06

LogP: -0.08

LogS: -2.66

Acceptors: 10

Donors: 6

Rotation Bonds: 19

Chiral Centers: 0

N+O: 12

LIPINSKY: 2

IUPAC: 8-((1E)-4-dibenzo[b,d]furan-2-yloxy-2-azabut-1-enyl)-2-[8-((1E)-4-dibenzo[b,d] furan-2-yloxy-2-azabut-1-enyl)-1,6,7-trihydroxy-3-methyl-5-(methylethyl)(2-nap hthyl)]-3-methyl-5-(methylethyl)naphthalene-1,6,7-triol

Smiles: c1(c2c(c3c(c(O)c(c(c3cc2C)C(C)C)O)/C=NCCOc2cc3c4c(cccc4)oc3cc2)O)c(c2c(c(O)c(c(c2cc1C)C(C)C)O)/C=NCCOc1cc2c3c(cccc3)oc2cc1)O