Natural Compounds

ST092587


Formula: C58H68N2O8

MW: 921.19

LogP: 2.72

LogS: -4.33

Acceptors: 8

Donors: 6

Rotation Bonds: 17

Chiral Centers: 0

N+O: 10

LIPINSKY: 2

IUPAC: 8-[(1E)-4-(4-cyclohexylphenoxy)-2-azabut-1-enyl]-2-{8-[(1E)-4-(4-cyclohexylphe noxy)-2-azabut-1-enyl]-1,6,7-trihydroxy-3-methyl-5-(methylethyl)(2-naphthyl)}- 3-methyl-5-(methylethyl)naphthalene-1,6,7-triol

Smiles: c1(c2c(c3c(c(O)c(c(c3cc2C)C(C)C)O)/C=NCCOc2ccc(cc2)C2CCCCC2)O)c(c2c(c(O)c(c(c2cc1C)C(C)C)O)/C=NCCOc1ccc(cc1)C1CCCCC1)O