Natural Compounds

ST092971


Formula: C48H48N6O6

MW: 804.95

LogP: -1.65

LogS: -3.07

Acceptors: 6

Donors: 8

Rotation Bonds: 11

Chiral Centers: 0

N+O: 12

LIPINSKY: 2

IUPAC: 8-[(1E)-2-(5,6-dimethylbenzimidazol-7-yl)-2-azavinyl]-2-{8-[(1E)-2-(5,6-dimeth ylbenzimidazol-7-yl)-2-azavinyl]-1,6,7-trihydroxy-3-methyl-5-(methylethyl)(2-n aphthyl)}-3-methyl-5-(methylethyl)naphthalene-1,6,7-triol

Smiles: c1(c2c(cc(c(c2O)c2c(c3c(c(O)c(c(c3cc2C)C(C)C)O)/C=Nc2c(c(cc3c2[nH]cn3)C)C)O)C)c(c(c1O)O)C(C)C)/C=Nc1c(c(cc2c1[nH]cn2)C)C