Natural Compounds

ST092972


Formula: C50H50N4O8

MW: 834.97

LogP: 1.82

LogS: -4.48

Acceptors: 8

Donors: 6

Rotation Bonds: 11

Chiral Centers: 0

N+O: 12

LIPINSKY: 2

IUPAC: 1-(3-{(1E)-2-[7-(8-{(1E)-2-[3-(2-oxopyrrolidinyl)phenyl]-2-azavinyl}-1,6,7-tri hydroxy-3-methyl-5-(methylethyl)(2-naphthyl))-2,3,8-trihydroxy-6-methyl-4-(met hylethyl)naphthyl]-1-azavinyl}phenyl)pyrrolidin-2-one

Smiles: c1(c2c(cc(c(c2O)c2c(c3c(c(O)c(c(c3cc2C)C(C)C)O)/C=Nc2cc(ccc2)N2C(CCC2)=O)O)C)c(c(c1O)O)C(C)C)/C=Nc1cccc(c1)N1C(CCC1)=O