Natural Compounds

ST095849 2',4'-Dihydroxy-3,4-dimethoxychalcone


Formula: C17H16O5

MW: 300.31

2',4'-DIHYDROXY-3,4-DIMETHOXYCHALCONE

LogP: 2.85

LogS: -3.94

Acceptors: 5

Donors: 2

Rotation Bonds: 7

Chiral Centers: 0

N+O: 5

LIPINSKY: 4

IUPAC: (2E)-1-(2,4-dihydroxyphenyl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one

Smiles: c1(c(cc(cc1)O)O)C(/C=Cc1cc(c(OC)cc1)OC)=O

Specification: 2',4'-DIHYDROXY-3,4-DIMETHOXYCHALCONE

2',4'-DIHYDROXY-3,4-DIMETHOXYCHALCONE Usage And Synthesis 2',4'-DIHYDROXY-3,4-DIMETHOXYCHALCONE